C24H31NO4 — CID 71126177
7-[(2R)-2-[(E)-4-(3,5-dimethylphenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid (PubChem CID 71126177) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 7-[(2R)-2-[(E)-4-(3,5-dimethylphenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid.
| Compound Name | 7-[(2R)-2-[(E)-4-(3,5-dimethylphenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 71126177 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 7-[(2R)-2-[(E)-4-(3,5-dimethylphenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid |
| SMILES | Cc1cc(C)cc(CC(O)/C=C/[C@H]2CCCC(=O)N2CC#CCCCC(=O)O)c1 |
| InChI | InChI=1S/C24H31NO4/c1-18-14-19(2)16-20(15-18)17-22(26)12-11-21-8-7-9-23(27)25(21)13-6-4-3-5-10-24(28)29/h11-12,14-16,21-22,26H,3,5,7-10,13,17H2,1-2H3,(H,28,29)/b12-11+/t21-,22?/m1/s1 |
| InChIKey | TUUFXEUJNMCWLC-YJWAVEFUSA-N |
| XLogP | 3.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|