C21H24ClNO5 — CID 67011384
2-[4-[2-[(E,3R)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-ynoxy]acetic acid (PubChem CID 67011384) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-[4-[2-[(E,3R)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-ynoxy]acetic acid.
| Compound Name | 2-[4-[2-[(E,3R)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-ynoxy]acetic acid |
|---|---|
| PubChem CID | 67011384 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[4-[2-[(E,3R)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-ynoxy]acetic acid |
| SMILES | O=C(O)COCC#CCN1C(=O)CCCC1/C=C/[C@H](O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H24ClNO5/c22-17-6-3-5-16(13-17)14-19(24)10-9-18-7-4-8-20(25)23(18)11-1-2-12-28-15-21(26)27/h3,5-6,9-10,13,18-19,24H,4,7-8,11-12,14-15H2,(H,26,27)/b10-9+/t18?,19-/m0/s1 |
| InChIKey | LPEUSZSVDXCEMU-RXBOESKCSA-N |
| XLogP | 2.29 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|