C21H26ClNO4 — CID 11440740
(6R)-6-[(E)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[4-(2-hydroxyethoxy)but-2-ynyl]piperidin-2-one (PubChem CID 11440740) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is (6R)-6-[(E)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[4-(2-hydroxyethoxy)but-2-ynyl]piperidin-2-one.
| Compound Name | (6R)-6-[(E)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[4-(2-hydroxyethoxy)but-2-ynyl]piperidin-2-one |
|---|---|
| PubChem CID | 11440740 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (6R)-6-[(E)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[4-(2-hydroxyethoxy)but-2-ynyl]piperidin-2-one |
| SMILES | O=C1CCC[C@H](/C=C/C(O)Cc2cccc(Cl)c2)N1CC#CCOCCO |
| InChI | InChI=1S/C21H26ClNO4/c22-18-6-3-5-17(15-18)16-20(25)10-9-19-7-4-8-21(26)23(19)11-1-2-13-27-14-12-24/h3,5-6,9-10,15,19-20,24-25H,4,7-8,11-14,16H2/b10-9+/t19-,20?/m1/s1 |
| InChIKey | XJBDYSZZGSHJBC-SJIDKOTRSA-N |
| XLogP | 2.19 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|