C21H26ClNO4S — CID 162280973
2-[4-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enylsulfanyl]acetic acid (PubChem CID 162280973) has the molecular formula C21H26ClNO4S and a molecular weight of 423.96 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 162280973 |
| Molecular Formula | C21H26ClNO4S |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-[4-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]but-2-enylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCC=CCN1C(=O)CCC[C@@H]1C=CC(O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClNO4S/c22-17-6-3-5-16(13-17)14-19(24)10-9-18-7-4-8-20(25)23(18)11-1-2-12-28-15-21(26)27/h1-3,5-6,9-10,13,18-19,24H,4,7-8,11-12,14-15H2,(H,26,27)/t18-,19?/m1/s1 |
| InChIKey | VQLMZWYRLRYLRV-MRTLOADZSA-N |
| XLogP | 3.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|