C23H35NO4 — CID 90731232
7-[(2R)-2-[3-hydroxy-4-(1-propylcyclopropyl)but-1-enyl]-7-oxoazepan-1-yl]hept-5-ynoic acid (PubChem CID 90731232) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 7-[(2R)-2-[3-hydroxy-4-(1-propylcyclopropyl)but-1-enyl]-7-oxoazepan-1-yl]hept-5-ynoic acid.
| Compound Name | 7-[(2R)-2-[3-hydroxy-4-(1-propylcyclopropyl)but-1-enyl]-7-oxoazepan-1-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 90731232 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 7-[(2R)-2-[3-hydroxy-4-(1-propylcyclopropyl)but-1-enyl]-7-oxoazepan-1-yl]hept-5-ynoic acid |
| SMILES | CCCC1(CC(O)C=C[C@H]2CCCCC(=O)N2CC#CCCCC(=O)O)CC1 |
| InChI | InChI=1S/C23H35NO4/c1-2-14-23(15-16-23)18-20(25)13-12-19-9-6-7-10-21(26)24(19)17-8-4-3-5-11-22(27)28/h12-13,19-20,25H,2-3,5-7,9-11,14-18H2,1H3,(H,27,28)/t19-,20?/m1/s1 |
| InChIKey | STWQSFJUJWPJIB-FIWHBWSRSA-N |
| XLogP | 3.90 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|