C21H28N2O7 — CID 162280959
3-[3-[(2R)-2-[3-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-oxopiperidin-1-yl]propoxy]propanoic acid (PubChem CID 162280959) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-[3-[(2R)-2-[3-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-oxopiperidin-1-yl]propoxy]propanoic acid.
| Compound Name | 3-[3-[(2R)-2-[3-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-oxopiperidin-1-yl]propoxy]propanoic acid |
|---|---|
| PubChem CID | 162280959 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-[3-[(2R)-2-[3-hydroxy-4-(4-nitrophenyl)but-1-enyl]-6-oxopiperidin-1-yl]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCN1C(=O)CCC[C@@H]1C=CC(O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H28N2O7/c24-19(15-16-5-7-18(8-6-16)23(28)29)10-9-17-3-1-4-20(25)22(17)12-2-13-30-14-11-21(26)27/h5-10,17,19,24H,1-4,11-15H2,(H,26,27)/t17-,19?/m1/s1 |
| InChIKey | FDLJSIUYJVRIPR-DUSLRRAJSA-N |
| XLogP | 2.32 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|