C22H27NO6 — CID 59793835
7-[(4R)-4-[(E)-3-hydroxy-4-(3-methoxyphenyl)but-1-enyl]-2-oxo-1,3-oxazinan-3-yl]hept-5-ynoic acid (PubChem CID 59793835) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 7-[(4R)-4-[(E)-3-hydroxy-4-(3-methoxyphenyl)but-1-enyl]-2-oxo-1,3-oxazinan-3-yl]hept-5-ynoic acid.
| Compound Name | 7-[(4R)-4-[(E)-3-hydroxy-4-(3-methoxyphenyl)but-1-enyl]-2-oxo-1,3-oxazinan-3-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 59793835 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 7-[(4R)-4-[(E)-3-hydroxy-4-(3-methoxyphenyl)but-1-enyl]-2-oxo-1,3-oxazinan-3-yl]hept-5-ynoic acid |
| SMILES | COc1cccc(CC(O)/C=C/[C@H]2CCOC(=O)N2CC#CCCCC(=O)O)c1 |
| InChI | InChI=1S/C22H27NO6/c1-28-20-8-6-7-17(16-20)15-19(24)11-10-18-12-14-29-22(27)23(18)13-5-3-2-4-9-21(25)26/h6-8,10-11,16,18-19,24H,2,4,9,12-15H2,1H3,(H,25,26)/b11-10+/t18-,19?/m0/s1 |
| InChIKey | BFTYVKXQJLEYLV-SBWIZCAUSA-N |
| XLogP | 2.62 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|