C14H17ClO4 — CID 54478231
methyl 7-(1-chloro-2,6-dioxocyclohexyl)hept-5-ynoate (PubChem CID 54478231) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 7-(1-chloro-2,6-dioxocyclohexyl)hept-5-ynoate.
| Compound Name | methyl 7-(1-chloro-2,6-dioxocyclohexyl)hept-5-ynoate |
|---|---|
| PubChem CID | 54478231 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 7-(1-chloro-2,6-dioxocyclohexyl)hept-5-ynoate |
| SMILES | COC(=O)CCCC#CCC1(Cl)C(=O)CCCC1=O |
| InChI | InChI=1S/C14H17ClO4/c1-19-13(18)9-4-2-3-5-10-14(15)11(16)7-6-8-12(14)17/h2,4,6-10H2,1H3 |
| InChIKey | XNCOJMMRSUMRCR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|