C20H33NO3SSi — CID 10992920
tert-butyl-[[(2S,3S)-3-ethenyl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]methoxy]-dimethylsilane (PubChem CID 10992920) has the molecular formula C20H33NO3SSi and a molecular weight of 395.64 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-3-ethenyl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-3-ethenyl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10992920 |
| Molecular Formula | C20H33NO3SSi |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl-[[(2S,3S)-3-ethenyl-1-(2,4,6-trimethylphenyl)sulfonylaziridin-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)N1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H33NO3SSi/c1-10-17-18(13-24-26(8,9)20(5,6)7)21(17)25(22,23)19-15(3)11-14(2)12-16(19)4/h10-12,17-18H,1,13H2,2-9H3/t17-,18+,21?/m0/s1 |
| InChIKey | QJNLIRPVPUALLC-GARIHTGFSA-N |
| XLogP | 4.56 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|