C23H29N5O6S2 — CID 134984092
2-[3-[(2S,3R)-3-ethenyl-1-(4-nitrophenyl)sulfonylaziridin-2-yl]propyl]-1-(2,4,6-trimethylphenyl)sulfonylguanidine (PubChem CID 134984092) has the molecular formula C23H29N5O6S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[3-[(2S,3R)-3-ethenyl-1-(4-nitrophenyl)sulfonylaziridin-2-yl]propyl]-1-(2,4,6-trimethylphenyl)sulfonylguanidine.
| Compound Name | 2-[3-[(2S,3R)-3-ethenyl-1-(4-nitrophenyl)sulfonylaziridin-2-yl]propyl]-1-(2,4,6-trimethylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 134984092 |
| Molecular Formula | C23H29N5O6S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 2-[3-[(2S,3R)-3-ethenyl-1-(4-nitrophenyl)sulfonylaziridin-2-yl]propyl]-1-(2,4,6-trimethylphenyl)sulfonylguanidine |
| SMILES | C=C[C@@H]1[C@H](CCC/N=C(\N)NS(=O)(=O)c2c(C)cc(C)cc2C)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N5O6S2/c1-5-20-21(27(20)36(33,34)19-10-8-18(9-11-19)28(29)30)7-6-12-25-23(24)26-35(31,32)22-16(3)13-15(2)14-17(22)4/h5,8-11,13-14,20-21H,1,6-7,12H2,2-4H3,(H3,24,25,26)/t20-,21+,27?/m1/s1 |
| InChIKey | BZVJEMXKXICFNG-OFTICUHGSA-N |
| XLogP | 2.52 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|