C31H35N5O8S2 — CID 134883993
benzyl (E)-3-[(2R,3S)-3-[3-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]propyl]-1-(4-nitrophenyl)sulfonylaziridin-2-yl]prop-2-enoate (PubChem CID 134883993) has the molecular formula C31H35N5O8S2 and a molecular weight of 669.78 g/mol. Its IUPAC name is benzyl (E)-3-[(2R,3S)-3-[3-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]propyl]-1-(4-nitrophenyl)sulfonylaziridin-2-yl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[(2R,3S)-3-[3-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]propyl]-1-(4-nitrophenyl)sulfonylaziridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134883993 |
| Molecular Formula | C31H35N5O8S2 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | benzyl (E)-3-[(2R,3S)-3-[3-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]propyl]-1-(4-nitrophenyl)sulfonylaziridin-2-yl]prop-2-enoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H]2[C@@H](/C=C/C(=O)OCc3ccccc3)N2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C31H35N5O8S2/c1-21-18-22(2)30(23(3)19-21)45(40,41)34-31(32)33-17-7-10-27-28(15-16-29(37)44-20-24-8-5-4-6-9-24)35(27)46(42,43)26-13-11-25(12-14-26)36(38)39/h4-6,8-9,11-16,18-19,27-28H,7,10,17,20H2,1-3H3,(H3,32,33,34)/b16-15+/t27-,28+,35?/m0/s1 |
| InChIKey | NEWFMFQBZBGSHD-MRNZISLRSA-N |
| XLogP | 3.63 |
| TPSA | 191.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|