C24H29N5O6S — CID 74941389
5-[[amino-[(1,2-dimethylindol-3-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 74941389) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is 5-[[amino-[(1,2-dimethylindol-3-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[[amino-[(1,2-dimethylindol-3-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 74941389 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 5-[[amino-[(1,2-dimethylindol-3-yl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1c(S(=O)(=O)N/C(N)=N/CCCC(NC(=O)OCc2ccccc2)C(=O)O)c2ccccc2n1C |
| InChI | InChI=1S/C24H29N5O6S/c1-16-21(18-11-6-7-13-20(18)29(16)2)36(33,34)28-23(25)26-14-8-12-19(22(30)31)27-24(32)35-15-17-9-4-3-5-10-17/h3-7,9-11,13,19H,8,12,14-15H2,1-2H3,(H,27,32)(H,30,31)(H3,25,26,28) |
| InChIKey | ULCFIIMNFPRDLK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 165.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|