C22H26N6O3 — CID 46882014
benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]carbamate (PubChem CID 46882014) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46882014 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(1-methylbenzimidazol-2-yl)-1-oxopentan-2-yl]carbamate |
| SMILES | Cn1c(C(=O)[C@H](CCCN=C(N)N)NC(=O)OCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C22H26N6O3/c1-28-18-12-6-5-10-16(18)26-20(28)19(29)17(11-7-13-25-21(23)24)27-22(30)31-14-15-8-3-2-4-9-15/h2-6,8-10,12,17H,7,11,13-14H2,1H3,(H,27,30)(H4,23,24,25)/t17-/m0/s1 |
| InChIKey | STTXDKYPMIFJCR-KRWDZBQOSA-N |
| XLogP | 2.10 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|