C30H43N7O8S — CID 10723037
benzyl 2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-5-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate (PubChem CID 10723037) has the molecular formula C30H43N7O8S and a molecular weight of 661.78 g/mol. Its IUPAC name is benzyl 2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-5-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-5-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 10723037 |
| Molecular Formula | C30H43N7O8S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | benzyl 2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-5-[[amino-[(2,4,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoyl]amino]acetate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)CNC(=O)[C@@H](N)[C@@H](C)O)C(=O)NCC(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H43N7O8S/c1-18-13-19(2)27(20(3)14-18)46(43,44)37-30(32)33-12-8-11-23(36-24(39)15-34-29(42)26(31)21(4)38)28(41)35-16-25(40)45-17-22-9-6-5-7-10-22/h5-7,9-10,13-14,21,23,26,38H,8,11-12,15-17,31H2,1-4H3,(H,34,42)(H,35,41)(H,36,39)(H3,32,33,37)/t21-,23+,26+/m1/s1 |
| InChIKey | QWNOYBAIKPVVHG-JJTGBXKASA-N |
| XLogP | -0.85 |
| TPSA | 244.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|