C25H22N2O5S — CID 172766117
(3S)-6,8-dimethyl-2-(4-nitrophenyl)sulfonyl-3-[(E)-2-phenylethenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 172766117) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is (3S)-6,8-dimethyl-2-(4-nitrophenyl)sulfonyl-3-[(E)-2-phenylethenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3S)-6,8-dimethyl-2-(4-nitrophenyl)sulfonyl-3-[(E)-2-phenylethenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 172766117 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (3S)-6,8-dimethyl-2-(4-nitrophenyl)sulfonyl-3-[(E)-2-phenylethenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1cc(C)c2c(c1)C[C@@H](/C=C/c1ccccc1)N(S(=O)(=O)c1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C25H22N2O5S/c1-17-14-18(2)24-20(15-17)16-22(9-8-19-6-4-3-5-7-19)26(25(24)28)33(31,32)23-12-10-21(11-13-23)27(29)30/h3-15,22H,16H2,1-2H3/b9-8+/t22-/m1/s1 |
| InChIKey | MIJJKRKEAKVHIK-HYGBKTPJSA-N |
| XLogP | 4.68 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|