C23H18Cl2N2O5S — CID 66552319
(2R,5S)-2-(2,4-dichlorophenyl)-3-(4-nitrophenyl)sulfonyl-5-[(E)-2-phenylethenyl]-1,3-oxazolidine (PubChem CID 66552319) has the molecular formula C23H18Cl2N2O5S and a molecular weight of 505.38 g/mol. Its IUPAC name is (2R,5S)-2-(2,4-dichlorophenyl)-3-(4-nitrophenyl)sulfonyl-5-[(E)-2-phenylethenyl]-1,3-oxazolidine.
| Compound Name | (2R,5S)-2-(2,4-dichlorophenyl)-3-(4-nitrophenyl)sulfonyl-5-[(E)-2-phenylethenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 66552319 |
| Molecular Formula | C23H18Cl2N2O5S |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | (2R,5S)-2-(2,4-dichlorophenyl)-3-(4-nitrophenyl)sulfonyl-5-[(E)-2-phenylethenyl]-1,3-oxazolidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2C[C@H](/C=C/c3ccccc3)O[C@@H]2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O5S/c24-17-7-13-21(22(25)14-17)23-26(15-19(32-23)10-6-16-4-2-1-3-5-16)33(30,31)20-11-8-18(9-12-20)27(28)29/h1-14,19,23H,15H2/b10-6+/t19-,23+/m0/s1 |
| InChIKey | LMRCGYGFFSTUKE-CNOUNZLZSA-N |
| XLogP | 5.70 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|