C18H18Cl2N4O5S — CID 17052258
(Z)-[2-[3-(benzenesulfonyl)-2-(2,4-dichlorophenyl)imidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium (PubChem CID 17052258) has the molecular formula C18H18Cl2N4O5S and a molecular weight of 473.34 g/mol. Its IUPAC name is (Z)-[2-[3-(benzenesulfonyl)-2-(2,4-dichlorophenyl)imidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium.
| Compound Name | (Z)-[2-[3-(benzenesulfonyl)-2-(2,4-dichlorophenyl)imidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
|---|---|
| PubChem CID | 17052258 |
| Molecular Formula | C18H18Cl2N4O5S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (Z)-[2-[3-(benzenesulfonyl)-2-(2,4-dichlorophenyl)imidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
| SMILES | CO/N=[N+](\[O-])CC(=O)N1CCN(S(=O)(=O)c2ccccc2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N4O5S/c1-29-21-24(26)12-17(25)22-9-10-23(30(27,28)14-5-3-2-4-6-14)18(22)15-8-7-13(19)11-16(15)20/h2-8,11,18H,9-10,12H2,1H3/b24-21- |
| InChIKey | UVCNWVPHWRXTAO-FLFQWRMESA-N |
| XLogP | 3.05 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|