C24H33N5O5S — CID 17052288
(Z)-[2-[2-[4-(diethylamino)phenyl]-3-(4-methylphenyl)sulfonyl-1,3-diazinan-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium (PubChem CID 17052288) has the molecular formula C24H33N5O5S and a molecular weight of 503.63 g/mol. Its IUPAC name is (Z)-[2-[2-[4-(diethylamino)phenyl]-3-(4-methylphenyl)sulfonyl-1,3-diazinan-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium.
| Compound Name | (Z)-[2-[2-[4-(diethylamino)phenyl]-3-(4-methylphenyl)sulfonyl-1,3-diazinan-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
|---|---|
| PubChem CID | 17052288 |
| Molecular Formula | C24H33N5O5S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (Z)-[2-[2-[4-(diethylamino)phenyl]-3-(4-methylphenyl)sulfonyl-1,3-diazinan-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
| SMILES | CCN(CC)c1ccc(C2N(C(=O)C/[N+]([O-])=N/OC)CCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H33N5O5S/c1-5-26(6-2)21-12-10-20(11-13-21)24-27(23(30)18-29(31)25-34-4)16-7-17-28(24)35(32,33)22-14-8-19(3)9-15-22/h8-15,24H,5-7,16-18H2,1-4H3/b29-25- |
| InChIKey | HARKLNWPFPDEGL-GNVQSUKOSA-N |
| XLogP | 3.29 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|