C23H31N5O5S — CID 17052249
(Z)-[2-[3-(benzenesulfonyl)-2-[4-(diethylamino)phenyl]-5-methylimidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium (PubChem CID 17052249) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is (Z)-[2-[3-(benzenesulfonyl)-2-[4-(diethylamino)phenyl]-5-methylimidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium.
| Compound Name | (Z)-[2-[3-(benzenesulfonyl)-2-[4-(diethylamino)phenyl]-5-methylimidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
|---|---|
| PubChem CID | 17052249 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (Z)-[2-[3-(benzenesulfonyl)-2-[4-(diethylamino)phenyl]-5-methylimidazolidin-1-yl]-2-oxoethyl]-methoxyimino-oxidoazanium |
| SMILES | CCN(CC)c1ccc(C2N(C(=O)C/[N+]([O-])=N/OC)C(C)CN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31N5O5S/c1-5-25(6-2)20-14-12-19(13-15-20)23-26(34(31,32)21-10-8-7-9-11-21)16-18(3)28(23)22(29)17-27(30)24-33-4/h7-15,18,23H,5-6,16-17H2,1-4H3/b27-24- |
| InChIKey | IQZNPWMFCLMNHA-PNHLSOANSA-N |
| XLogP | 2.98 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|