C25H29N3O4S2 — CID 17371195
4-[3-(benzenesulfonyl)-4-methyl-1-(4-methylphenyl)sulfonylimidazolidin-2-yl]-N,N-dimethylaniline (PubChem CID 17371195) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-[3-(benzenesulfonyl)-4-methyl-1-(4-methylphenyl)sulfonylimidazolidin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-(benzenesulfonyl)-4-methyl-1-(4-methylphenyl)sulfonylimidazolidin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 17371195 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-[3-(benzenesulfonyl)-4-methyl-1-(4-methylphenyl)sulfonylimidazolidin-2-yl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)N(S(=O)(=O)c3ccccc3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-19-10-16-24(17-11-19)33(29,30)27-18-20(2)28(34(31,32)23-8-6-5-7-9-23)25(27)21-12-14-22(15-13-21)26(3)4/h5-17,20,25H,18H2,1-4H3 |
| InChIKey | PKNQQRGWNIHGLG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|