C18H21ClN2O2S — CID 175257353
(2S)-1-(benzenesulfonyl)-4-[(3-chlorophenyl)methyl]-2-methylpiperazine (PubChem CID 175257353) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-4-[(3-chlorophenyl)methyl]-2-methylpiperazine.
| Compound Name | (2S)-1-(benzenesulfonyl)-4-[(3-chlorophenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 175257353 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-4-[(3-chlorophenyl)methyl]-2-methylpiperazine |
| SMILES | C[C@H]1CN(Cc2cccc(Cl)c2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-15-13-20(14-16-6-5-7-17(19)12-16)10-11-21(15)24(22,23)18-8-3-2-4-9-18/h2-9,12,15H,10-11,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | DLMHANXKTPVQOY-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |