C20H25ClN2O2S — CID 141177938
(2S)-4-[(3-chlorophenyl)methyl]-2-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine (PubChem CID 141177938) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is (2S)-4-[(3-chlorophenyl)methyl]-2-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine.
| Compound Name | (2S)-4-[(3-chlorophenyl)methyl]-2-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 141177938 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (2S)-4-[(3-chlorophenyl)methyl]-2-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCN(Cc3cccc(Cl)c3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C20H25ClN2O2S/c1-16-5-3-7-19(11-16)15-26(24,25)23-10-9-22(13-17(23)2)14-18-6-4-8-20(21)12-18/h3-8,11-12,17H,9-10,13-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | GYYKOGDPYXIXCN-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |