C20H31NO5S — CID 72701317
(3R,5R)-2-(4-methylphenyl)sulfonyl-5-nonyl-1,2-oxazolidine-3-carboxylic acid (PubChem CID 72701317) has the molecular formula C20H31NO5S and a molecular weight of 397.54 g/mol. Its IUPAC name is (3R,5R)-2-(4-methylphenyl)sulfonyl-5-nonyl-1,2-oxazolidine-3-carboxylic acid.
| Compound Name | (3R,5R)-2-(4-methylphenyl)sulfonyl-5-nonyl-1,2-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72701317 |
| Molecular Formula | C20H31NO5S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (3R,5R)-2-(4-methylphenyl)sulfonyl-5-nonyl-1,2-oxazolidine-3-carboxylic acid |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](C(=O)O)N(S(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C20H31NO5S/c1-3-4-5-6-7-8-9-10-17-15-19(20(22)23)21(26-17)27(24,25)18-13-11-16(2)12-14-18/h11-14,17,19H,3-10,15H2,1-2H3,(H,22,23)/t17-,19-/m1/s1 |
| InChIKey | OVHYDJWLZWMBPU-IEBWSBKVSA-N |
| XLogP | 4.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|