C24H23NO5S — CID 134866569
3-[2-(methoxymethoxy)phenyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one (PubChem CID 134866569) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[2-(methoxymethoxy)phenyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one.
| Compound Name | 3-[2-(methoxymethoxy)phenyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 134866569 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[2-(methoxymethoxy)phenyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroquinolin-4-one |
| SMILES | COCOc1ccccc1C1CN(S(=O)(=O)c2ccc(C)cc2)c2ccccc2C1=O |
| InChI | InChI=1S/C24H23NO5S/c1-17-11-13-18(14-12-17)31(27,28)25-15-21(24(26)20-8-3-5-9-22(20)25)19-7-4-6-10-23(19)30-16-29-2/h3-14,21H,15-16H2,1-2H3 |
| InChIKey | QOOCYJXVTBXHEO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|