C17H18N4O2S — CID 175207178
3-azido-5-ethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 175207178) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-azido-5-ethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 3-azido-5-ethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 175207178 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-azido-5-ethyl-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | CCc1ccc2c(c1)C(N=[N+]=[N-])CN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N4O2S/c1-3-13-6-9-17-15(10-13)16(19-20-18)11-21(17)24(22,23)14-7-4-12(2)5-8-14/h4-10,16H,3,11H2,1-2H3 |
| InChIKey | VOEORHYCKXIIQW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|