C22H33NO2S — CID 16753058
(3R)-3-(2-methylprop-1-enyl)-2-(2,4,6-trimethylphenyl)sulfonyl-2-azaspiro[4.5]decane (PubChem CID 16753058) has the molecular formula C22H33NO2S and a molecular weight of 375.58 g/mol. Its IUPAC name is (3R)-3-(2-methylprop-1-enyl)-2-(2,4,6-trimethylphenyl)sulfonyl-2-azaspiro[4.5]decane.
| Compound Name | (3R)-3-(2-methylprop-1-enyl)-2-(2,4,6-trimethylphenyl)sulfonyl-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 16753058 |
| Molecular Formula | C22H33NO2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3R)-3-(2-methylprop-1-enyl)-2-(2,4,6-trimethylphenyl)sulfonyl-2-azaspiro[4.5]decane |
| SMILES | CC(C)=C[C@H]1CC2(CCCCC2)CN1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H33NO2S/c1-16(2)11-20-14-22(9-7-6-8-10-22)15-23(20)26(24,25)21-18(4)12-17(3)13-19(21)5/h11-13,20H,6-10,14-15H2,1-5H3/t20-/m0/s1 |
| InChIKey | BEMBFQVPRGVRIA-FQEVSTJZSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|