C21H24N2O4S — CID 40558801
(2R,3S)-2-azaniumyl-3-[1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]butanoate (PubChem CID 40558801) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2R,3S)-2-azaniumyl-3-[1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]butanoate.
| Compound Name | (2R,3S)-2-azaniumyl-3-[1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]butanoate |
|---|---|
| PubChem CID | 40558801 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R,3S)-2-azaniumyl-3-[1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]butanoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc([C@H](C)[C@@H]([NH3+])C(=O)[O-])c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H24N2O4S/c1-12-9-13(2)20(14(3)10-12)28(26,27)23-11-17(15(4)19(22)21(24)25)16-7-5-6-8-18(16)23/h5-11,15,19H,22H2,1-4H3,(H,24,25)/t15-,19+/m0/s1 |
| InChIKey | QOZDNUGOXUHAFC-HNAYVOBHSA-N |
| XLogP | 1.27 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |