C19H17BrFNO3S — CID 121473320
2-bromo-1-[6-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone (PubChem CID 121473320) has the molecular formula C19H17BrFNO3S and a molecular weight of 438.32 g/mol. Its IUPAC name is 2-bromo-1-[6-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone.
| Compound Name | 2-bromo-1-[6-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 121473320 |
| Molecular Formula | C19H17BrFNO3S |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 2-bromo-1-[6-fluoro-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(C(=O)CBr)c3ccc(F)cc32)c(C)c1 |
| InChI | InChI=1S/C19H17BrFNO3S/c1-11-6-12(2)19(13(3)7-11)26(24,25)22-10-16(18(23)9-20)15-5-4-14(21)8-17(15)22/h4-8,10H,9H2,1-3H3 |
| InChIKey | KKVRFAVFELGTLS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|