C23H21ClF3NO3S — CID 154408671
2-chloro-1-[6-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone (PubChem CID 154408671) has the molecular formula C23H21ClF3NO3S and a molecular weight of 483.94 g/mol. Its IUPAC name is 2-chloro-1-[6-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[6-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone |
|---|---|
| PubChem CID | 154408671 |
| Molecular Formula | C23H21ClF3NO3S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-chloro-1-[6-[(1R,2R)-2-(trifluoromethyl)cyclopropyl]-1-(2,4,6-trimethylphenyl)sulfonylindol-3-yl]ethanone |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cc(C(=O)CCl)c3ccc([C@@H]4C[C@H]4C(F)(F)F)cc32)c(C)c1 |
| InChI | InChI=1S/C23H21ClF3NO3S/c1-12-6-13(2)22(14(3)7-12)32(30,31)28-11-18(21(29)10-24)16-5-4-15(8-20(16)28)17-9-19(17)23(25,26)27/h4-8,11,17,19H,9-10H2,1-3H3/t17-,19+/m0/s1 |
| InChIKey | JYXJLHMYTPONOF-PKOBYXMFSA-N |
| XLogP | 5.89 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|