C28H27NO5S — CID 135315524
[2-[4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]oxyphenyl] propanoate (PubChem CID 135315524) has the molecular formula C28H27NO5S and a molecular weight of 489.59 g/mol. Its IUPAC name is [2-[4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]oxyphenyl] propanoate.
| Compound Name | [2-[4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]oxyphenyl] propanoate |
|---|---|
| PubChem CID | 135315524 |
| Molecular Formula | C28H27NO5S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [2-[4-[(2,4,6-trimethylphenyl)sulfonylamino]naphthalen-1-yl]oxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1Oc1ccc(NS(=O)(=O)c2c(C)cc(C)cc2C)c2ccccc12 |
| InChI | InChI=1S/C28H27NO5S/c1-5-27(30)34-26-13-9-8-12-25(26)33-24-15-14-23(21-10-6-7-11-22(21)24)29-35(31,32)28-19(3)16-18(2)17-20(28)4/h6-17,29H,5H2,1-4H3 |
| InChIKey | AWFSADARORFPRS-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|