C15H17BrN2O2S — CID 107328567
N-(2-bromophenyl)-2,6-dimethyl-4-(methylamino)benzenesulfonamide (PubChem CID 107328567) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,6-dimethyl-4-(methylamino)benzenesulfonamide.
| Compound Name | N-(2-bromophenyl)-2,6-dimethyl-4-(methylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 107328567 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-(2-bromophenyl)-2,6-dimethyl-4-(methylamino)benzenesulfonamide |
| SMILES | CNc1cc(C)c(S(=O)(=O)Nc2ccccc2Br)c(C)c1 |
| InChI | InChI=1S/C15H17BrN2O2S/c1-10-8-12(17-3)9-11(2)15(10)21(19,20)18-14-7-5-4-6-13(14)16/h4-9,17-18H,1-3H3 |
| InChIKey | DVRMUVICXQGWFE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |