C13H17NO3S2 — CID 19591745
2-methyl-1,3-thiazol-3-ium;2,4,6-trimethylbenzenesulfonate (PubChem CID 19591745) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-methyl-1,3-thiazol-3-ium;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2-methyl-1,3-thiazol-3-ium;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 19591745 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-methyl-1,3-thiazol-3-ium;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1[nH+]ccs1.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C4H5NS/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-4-5-2-3-6-4/h4-5H,1-3H3,(H,10,11,12);2-3H,1H3 |
| InChIKey | LUQOKIYTCPPCJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|