C14H22N4O3S2 — CID 22220694
4-N,5-N-dimethyl-1,3-thiazol-3-ium-3,4,5-triamine;2,4,6-trimethylbenzenesulfonate (PubChem CID 22220694) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-N,5-N-dimethyl-1,3-thiazol-3-ium-3,4,5-triamine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 4-N,5-N-dimethyl-1,3-thiazol-3-ium-3,4,5-triamine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 22220694 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-N,5-N-dimethyl-1,3-thiazol-3-ium-3,4,5-triamine;2,4,6-trimethylbenzenesulfonate |
| SMILES | CNc1sc[n+](N)c1NC.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C5H11N4S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-7-4-5(8-2)10-3-9(4)6/h4-5H,1-3H3,(H,10,11,12);3,7-8H,6H2,1-2H3/q;+1/p-1 |
| InChIKey | UWTDCWIBRQSPCT-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|