C21H24N2O4S — CID 86618780
4-phenylmethoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 86618780) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-phenylmethoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 4-phenylmethoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 86618780 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-phenylmethoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C12H13N2O.C9H12O3S/c13-14-8-6-12(7-9-14)15-10-11-4-2-1-3-5-11;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h1-9H,10,13H2;4-5H,1-3H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | FCAZXGPYOGGXJC-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|