C20H22BrN3O4S — CID 154675263
5-bromo-6-phenoxypyridin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonate (PubChem CID 154675263) has the molecular formula C20H22BrN3O4S and a molecular weight of 480.38 g/mol. Its IUPAC name is 5-bromo-6-phenoxypyridin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 5-bromo-6-phenoxypyridin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 154675263 |
| Molecular Formula | C20H22BrN3O4S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 5-bromo-6-phenoxypyridin-1-ium-1,2-diamine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.Nc1ccc(Br)c(Oc2ccccc2)[n+]1N |
| InChI | InChI=1S/C11H10BrN3O.C9H12O3S/c12-9-6-7-10(13)15(14)11(9)16-8-4-2-1-3-5-8;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h1-7,13H,14H2;4-5H,1-3H3,(H,10,11,12) |
| InChIKey | YRQIZHPISKYNID-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|