C17H24N2O4S — CID 175150056
2-ethyl-4-methoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 175150056) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-ethyl-4-methoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2-ethyl-4-methoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 175150056 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-ethyl-4-methoxypyridin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | CCc1cc(OC)cc[n+]1N.Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C8H13N2O/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-3-7-6-8(11-2)4-5-10(7)9/h4-5H,1-3H3,(H,10,11,12);4-6H,3,9H2,1-2H3/q;+1/p-1 |
| InChIKey | VIORDAMYQYXNPS-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|