C14H20N4O3S — CID 14244821
4,6-dimethyltriazin-2-ium-2-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 14244821) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4,6-dimethyltriazin-2-ium-2-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 4,6-dimethyltriazin-2-ium-2-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 14244821 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4,6-dimethyltriazin-2-ium-2-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.Cc1cc(C)n[n+](N)n1 |
| InChI | InChI=1S/C9H12O3S.C5H9N4/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-4-3-5(2)8-9(6)7-4/h4-5H,1-3H3,(H,10,11,12);3H,1-2H3,(H2,6,7,8)/q;+1/p-1 |
| InChIKey | WHSIBUNUSAISPT-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|