C24H17N4NaO3S4 — CID 87758869
sodium;2-[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate;1,3-thiazole (PubChem CID 87758869) has the molecular formula C24H17N4NaO3S4 and a molecular weight of 560.68 g/mol. Its IUPAC name is sodium;2-[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate;1,3-thiazole.
| Compound Name | sodium;2-[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate;1,3-thiazole |
|---|---|
| PubChem CID | 87758869 |
| Molecular Formula | C24H17N4NaO3S4 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | sodium;2-[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate;1,3-thiazole |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(N)cc5)sc4c3)sc2c1S(=O)(=O)[O-].[Na+].c1cscn1 |
| InChI | InChI=1S/C21H15N3O3S3.C3H3NS.Na/c1-11-2-8-16-18(19(11)30(25,26)27)29-21(24-16)13-5-9-15-17(10-13)28-20(23-15)12-3-6-14(22)7-4-12;1-2-5-3-4-1;/h2-10H,22H2,1H3,(H,25,26,27);1-3H;/q;;+1/p-1 |
| InChIKey | OKGXUGCOCGKUSX-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|