C28H24N4O5S2 — CID 53377551
azanium 2-[4-[(4-benzamidobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate (PubChem CID 53377551) has the molecular formula C28H24N4O5S2 and a molecular weight of 560.66 g/mol. Its IUPAC name is azanium 2-[4-[(4-benzamidobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate.
| Compound Name | azanium 2-[4-[(4-benzamidobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
|---|---|
| PubChem CID | 53377551 |
| Molecular Formula | C28H24N4O5S2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | azanium 2-[4-[(4-benzamidobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4ccc(NC(=O)c5ccccc5)cc4)cc3)sc2c1S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C28H21N3O5S2.H3N/c1-17-7-16-23-24(25(17)38(34,35)36)37-28(31-23)20-10-14-22(15-11-20)30-27(33)19-8-12-21(13-9-19)29-26(32)18-5-3-2-4-6-18;/h2-16H,1H3,(H,29,32)(H,30,33)(H,34,35,36);1H3 |
| InChIKey | DOMYFICZNXXHDJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|