C28H20N4O4S3 — CID 53356654
6-methyl-2-[2-[4-(phenylcarbamoylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid (PubChem CID 53356654) has the molecular formula C28H20N4O4S3 and a molecular weight of 572.69 g/mol. Its IUPAC name is 6-methyl-2-[2-[4-(phenylcarbamoylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 6-methyl-2-[2-[4-(phenylcarbamoylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 53356654 |
| Molecular Formula | C28H20N4O4S3 |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 6-methyl-2-[2-[4-(phenylcarbamoylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(NC(=O)Nc6ccccc6)cc5)sc4c3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C28H20N4O4S3/c1-16-7-13-22-24(25(16)39(34,35)36)38-27(32-22)18-10-14-21-23(15-18)37-26(31-21)17-8-11-20(12-9-17)30-28(33)29-19-5-3-2-4-6-19/h2-15H,1H3,(H2,29,30,33)(H,34,35,36) |
| InChIKey | CSSYYVUIXCHLCJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|