C33H22N6O5S3 — CID 57351187
2-[2-[4-[2-[4,6-dioxo-5-(phenylhydrazinylidene)cyclohex-2-en-1-ylidene]hydrazinyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid (PubChem CID 57351187) has the molecular formula C33H22N6O5S3 and a molecular weight of 678.78 g/mol. Its IUPAC name is 2-[2-[4-[2-[4,6-dioxo-5-(phenylhydrazinylidene)cyclohex-2-en-1-ylidene]hydrazinyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 2-[2-[4-[2-[4,6-dioxo-5-(phenylhydrazinylidene)cyclohex-2-en-1-ylidene]hydrazinyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 57351187 |
| Molecular Formula | C33H22N6O5S3 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.08 |
| IUPAC Name | 2-[2-[4-[2-[4,6-dioxo-5-(phenylhydrazinylidene)cyclohex-2-en-1-ylidene]hydrazinyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(NN=c6ccc(=O)c(=NNc7ccccc7)c6=O)cc5)sc4c3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C33H22N6O5S3/c1-18-7-13-25-30(31(18)47(42,43)44)46-33(35-25)20-10-14-23-27(17-20)45-32(34-23)19-8-11-22(12-9-19)36-38-24-15-16-26(40)28(29(24)41)39-37-21-5-3-2-4-6-21/h2-17,36-37H,1H3,(H,42,43,44) |
| InChIKey | KJKBOTRKLVOQIA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|