C29H19ClN2O4S3 — CID 161285985
2-[2-[4-[2-(3-chlorophenyl)-2-oxoethyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid (PubChem CID 161285985) has the molecular formula C29H19ClN2O4S3 and a molecular weight of 591.14 g/mol. Its IUPAC name is 2-[2-[4-[2-(3-chlorophenyl)-2-oxoethyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 2-[2-[4-[2-(3-chlorophenyl)-2-oxoethyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 161285985 |
| Molecular Formula | C29H19ClN2O4S3 |
| Molecular Weight | 591.14 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2-[2-[4-[2-(3-chlorophenyl)-2-oxoethyl]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(CC(=O)c6cccc(Cl)c6)cc5)sc4c3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C29H19ClN2O4S3/c1-16-5-11-23-26(27(16)39(34,35)36)38-29(32-23)20-10-12-22-25(15-20)37-28(31-22)18-8-6-17(7-9-18)13-24(33)19-3-2-4-21(30)14-19/h2-12,14-15H,13H2,1H3,(H,34,35,36) |
| InChIKey | VFSLAPJKRDHNIT-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.14 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|