C21H15N3O3S3 — CID 101318495
2-[2-(4-aminophenyl)-1,3-benzothiazol-4-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid (PubChem CID 101318495) has the molecular formula C21H15N3O3S3 and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-1,3-benzothiazol-4-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 2-[2-(4-aminophenyl)-1,3-benzothiazol-4-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 101318495 |
| Molecular Formula | C21H15N3O3S3 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 2-[2-(4-aminophenyl)-1,3-benzothiazol-4-yl]-6-methyl-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3cccc4sc(-c5ccc(N)cc5)nc34)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C21H15N3O3S3/c1-11-5-10-15-18(19(11)30(25,26)27)29-21(23-15)14-3-2-4-16-17(14)24-20(28-16)12-6-8-13(22)9-7-12/h2-10H,22H2,1H3,(H,25,26,27) |
| InChIKey | MYGQEGCFTSKARP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|