C18H16N8O3S2 — CID 21305833
6-methyl-2-[4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]phenyl]-1,3-benzothiazole-7-sulfonic acid (PubChem CID 21305833) has the molecular formula C18H16N8O3S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is 6-methyl-2-[4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]phenyl]-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 6-methyl-2-[4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]phenyl]-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 21305833 |
| Molecular Formula | C18H16N8O3S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 6-methyl-2-[4-[(2,4,6-triaminopyrimidin-5-yl)diazenyl]phenyl]-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc(/N=N/c4c(N)nc(N)nc4N)cc3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C18H16N8O3S2/c1-8-2-7-11-13(14(8)31(27,28)29)30-17(22-11)9-3-5-10(6-4-9)25-26-12-15(19)23-18(21)24-16(12)20/h2-7H,1H3,(H,27,28,29)(H6,19,20,21,23,24)/b26-25+ |
| InChIKey | BSKTYZUOVKCCQU-OCEACIFDSA-N |
| XLogP | 3.47 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|