C21H20N4O4S2 — CID 53255452
azanium 2-[4-[(4-aminobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate (PubChem CID 53255452) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is azanium 2-[4-[(4-aminobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate.
| Compound Name | azanium 2-[4-[(4-aminobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
|---|---|
| PubChem CID | 53255452 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | azanium 2-[4-[(4-aminobenzoyl)amino]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4ccc(N)cc4)cc3)sc2c1S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C21H17N3O4S2.H3N/c1-12-2-11-17-18(19(12)30(26,27)28)29-21(24-17)14-5-9-16(10-6-14)23-20(25)13-3-7-15(22)8-4-13;/h2-11H,22H2,1H3,(H,23,25)(H,26,27,28);1H3 |
| InChIKey | GABXXSJHCXVGPK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|