C28H17ClN3O4S3- — CID 140650082
2-[2-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate (PubChem CID 140650082) has the molecular formula C28H17ClN3O4S3- and a molecular weight of 591.12 g/mol. Its IUPAC name is 2-[2-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate.
| Compound Name | 2-[2-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate |
|---|---|
| PubChem CID | 140650082 |
| Molecular Formula | C28H17ClN3O4S3- |
| Molecular Weight | 591.12 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 2-[2-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-benzothiazol-6-yl]-6-methyl-1,3-benzothiazole-7-sulfonate |
| SMILES | Cc1ccc2nc(-c3ccc4nc(-c5ccc(NC(=O)c6ccc(Cl)cc6)cc5)sc4c3)sc2c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C28H18ClN3O4S3/c1-15-2-12-22-24(25(15)39(34,35)36)38-28(32-22)18-7-13-21-23(14-18)37-27(31-21)17-5-10-20(11-6-17)30-26(33)16-3-8-19(29)9-4-16/h2-14H,1H3,(H,30,33)(H,34,35,36)/p-1 |
| InChIKey | YYYFAXTWXNQEFZ-UHFFFAOYSA-M |
| XLogP | 7.36 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.12 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|