C28H22N4O4S3 — CID 53377555
6-methyl-2-[4-[[4-(phenylcarbamothioylamino)benzoyl]amino]phenyl]-1,3-benzothiazole-7-sulfonic acid (PubChem CID 53377555) has the molecular formula C28H22N4O4S3 and a molecular weight of 574.71 g/mol. Its IUPAC name is 6-methyl-2-[4-[[4-(phenylcarbamothioylamino)benzoyl]amino]phenyl]-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | 6-methyl-2-[4-[[4-(phenylcarbamothioylamino)benzoyl]amino]phenyl]-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 53377555 |
| Molecular Formula | C28H22N4O4S3 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 6-methyl-2-[4-[[4-(phenylcarbamothioylamino)benzoyl]amino]phenyl]-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4ccc(NC(=S)Nc5ccccc5)cc4)cc3)sc2c1S(=O)(=O)O |
| InChI | InChI=1S/C28H22N4O4S3/c1-17-7-16-23-24(25(17)39(34,35)36)38-27(32-23)19-10-14-21(15-11-19)29-26(33)18-8-12-22(13-9-18)31-28(37)30-20-5-3-2-4-6-20/h2-16H,1H3,(H,29,33)(H2,30,31,37)(H,34,35,36) |
| InChIKey | XMHRPZWWLZSXKV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|