C14H14KN3O3S2 — CID 143103567
potassium;2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid;azanide (PubChem CID 143103567) has the molecular formula C14H14KN3O3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is potassium;2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid;azanide.
| Compound Name | potassium;2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid;azanide |
|---|---|
| PubChem CID | 143103567 |
| Molecular Formula | C14H14KN3O3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | potassium;2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid;azanide |
| SMILES | Cc1ccc2nc(-c3ccc(N)cc3)sc2c1S(=O)(=O)O.[K+].[NH2-] |
| InChI | InChI=1S/C14H12N2O3S2.K.H2N/c1-8-2-7-11-12(13(8)21(17,18)19)20-14(16-11)9-3-5-10(15)6-4-9;;/h2-7H,15H2,1H3,(H,17,18,19);;1H2/q;+1;-1 |
| InChIKey | ILFSRSYJSISZQW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|