C17H12N2O4S2 — CID 57351647
2-(4-aminophenyl)-6-hydroxybenzo[g][1,3]benzothiazole-8-sulfonic acid (PubChem CID 57351647) has the molecular formula C17H12N2O4S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-hydroxybenzo[g][1,3]benzothiazole-8-sulfonic acid.
| Compound Name | 2-(4-aminophenyl)-6-hydroxybenzo[g][1,3]benzothiazole-8-sulfonic acid |
|---|---|
| PubChem CID | 57351647 |
| Molecular Formula | C17H12N2O4S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-(4-aminophenyl)-6-hydroxybenzo[g][1,3]benzothiazole-8-sulfonic acid |
| SMILES | Nc1ccc(-c2nc3ccc4c(O)cc(S(=O)(=O)O)cc4c3s2)cc1 |
| InChI | InChI=1S/C17H12N2O4S2/c18-10-3-1-9(2-4-10)17-19-14-6-5-12-13(16(14)24-17)7-11(8-15(12)20)25(21,22)23/h1-8,20H,18H2,(H,21,22,23) |
| InChIKey | PFVVWLNXWYQVLJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|