C13H11N3S — CID 141212234
2-(4-aminophenyl)-1,3-benzothiazol-7-amine (PubChem CID 141212234) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1,3-benzothiazol-7-amine.
| Compound Name | 2-(4-aminophenyl)-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 141212234 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(4-aminophenyl)-1,3-benzothiazol-7-amine |
| SMILES | Nc1ccc(-c2nc3cccc(N)c3s2)cc1 |
| InChI | InChI=1S/C13H11N3S/c14-9-6-4-8(5-7-9)13-16-11-3-1-2-10(15)12(11)17-13/h1-7H,14-15H2 |
| InChIKey | PCMGUUXISOMCQS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|